C13H18 — CID 144588079
(3Z,5E)-5-ethenyl-2,3,4-trimethylocta-1,3,5,7-tetraene (PubChem CID 144588079) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (3Z,5E)-5-ethenyl-2,3,4-trimethylocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5E)-5-ethenyl-2,3,4-trimethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 144588079 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3Z,5E)-5-ethenyl-2,3,4-trimethylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C=C)/C(C)=C(/C)C(=C)C |
| InChI | InChI=1S/C13H18/c1-7-9-13(8-2)12(6)11(5)10(3)4/h7-9H,1-3H2,4-6H3/b12-11-,13-9+ |
| InChIKey | OBPZXQJEZCFNKK-MOCJCDOWSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|