C11H17Br — CID 144847010
(3E,5Z)-3-bromo-5-methylocta-1,3,5,7-tetraene;ethane (PubChem CID 144847010) has the molecular formula C11H17Br and a molecular weight of 229.16 g/mol. Its IUPAC name is (3E,5Z)-3-bromo-5-methylocta-1,3,5,7-tetraene;ethane.
| Compound Name | (3E,5Z)-3-bromo-5-methylocta-1,3,5,7-tetraene;ethane |
|---|---|
| PubChem CID | 144847010 |
| Molecular Formula | C11H17Br |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | (3E,5Z)-3-bromo-5-methylocta-1,3,5,7-tetraene;ethane |
| SMILES | C=C/C=C(C)\C=C(\Br)C=C.CC |
| InChI | InChI=1S/C9H11Br.C2H6/c1-4-6-8(3)7-9(10)5-2;1-2/h4-7H,1-2H2,3H3;1-2H3/b8-6-,9-7+; |
| InChIKey | ZUYVFBPSHUWGFH-JYWQNNPFSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|