C8H12O2 — CID 145263445
(3Z,5E)-6-hydroperoxy-4-methylhepta-1,3,5-triene (PubChem CID 145263445) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3Z,5E)-6-hydroperoxy-4-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-6-hydroperoxy-4-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 145263445 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3Z,5E)-6-hydroperoxy-4-methylhepta-1,3,5-triene |
| SMILES | C=C/C=C(C)\C=C(/C)OO |
| InChI | InChI=1S/C8H12O2/c1-4-5-7(2)6-8(3)10-9/h4-6,9H,1H2,2-3H3/b7-5-,8-6+ |
| InChIKey | WYCSEJCLCXDEMI-CGXWXWIYSA-N |
| XLogP | 2.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|