C11H14Br2 — CID 167298900
(3E,5E)-2-(dibromomethyl)-3,5-dimethylocta-1,3,5,7-tetraene (PubChem CID 167298900) has the molecular formula C11H14Br2 and a molecular weight of 306.04 g/mol. Its IUPAC name is (3E,5E)-2-(dibromomethyl)-3,5-dimethylocta-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-2-(dibromomethyl)-3,5-dimethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 167298900 |
| Molecular Formula | C11H14Br2 |
| Molecular Weight | 306.04 g/mol |
| Exact Mass | 303.95 |
| IUPAC Name | (3E,5E)-2-(dibromomethyl)-3,5-dimethylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C)/C=C(\C)C(=C)C(Br)Br |
| InChI | InChI=1S/C11H14Br2/c1-5-6-8(2)7-9(3)10(4)11(12)13/h5-7,11H,1,4H2,2-3H3/b8-6+,9-7+ |
| InChIKey | PERIJEWZZYJBMR-CDJQDVQCSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|