C11H16O — CID 118001222
(4E,6E)-4,6-dimethylnona-1,4,6,8-tetraen-2-ol (PubChem CID 118001222) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (4E,6E)-4,6-dimethylnona-1,4,6,8-tetraen-2-ol.
| Compound Name | (4E,6E)-4,6-dimethylnona-1,4,6,8-tetraen-2-ol |
|---|---|
| PubChem CID | 118001222 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (4E,6E)-4,6-dimethylnona-1,4,6,8-tetraen-2-ol |
| SMILES | C=C/C=C(C)/C=C(\C)CC(=C)O |
| InChI | InChI=1S/C11H16O/c1-5-6-9(2)7-10(3)8-11(4)12/h5-7,12H,1,4,8H2,2-3H3/b9-6+,10-7+ |
| InChIKey | OUPOUGQNZPXGAZ-KZZDLZNXSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|