C11H17N — CID 126706666
2-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropan-1-amine (PubChem CID 126706666) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropan-1-amine.
| Compound Name | 2-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 126706666 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-[(2E,4Z)-4-methylhepta-2,4,6-trien-2-yl]cyclopropan-1-amine |
| SMILES | C=C/C=C(C)\C=C(/C)C1CC1N |
| InChI | InChI=1S/C11H17N/c1-4-5-8(2)6-9(3)10-7-11(10)12/h4-6,10-11H,1,7,12H2,2-3H3/b8-5-,9-6+ |
| InChIKey | JYSPVIVTBHBWTG-LDFAFZTOSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|