C10H13BrO — CID 142904672
(3E,5E)-6-bromo-3-methoxy-4-methylocta-1,3,5,7-tetraene (PubChem CID 142904672) has the molecular formula C10H13BrO and a molecular weight of 229.12 g/mol. Its IUPAC name is (3E,5E)-6-bromo-3-methoxy-4-methylocta-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-6-bromo-3-methoxy-4-methylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 142904672 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (3E,5E)-6-bromo-3-methoxy-4-methylocta-1,3,5,7-tetraene |
| SMILES | C=C/C(Br)=C\C(C)=C(/C=C)OC |
| InChI | InChI=1S/C10H13BrO/c1-5-9(11)7-8(3)10(6-2)12-4/h5-7H,1-2H2,3-4H3/b9-7+,10-8+ |
| InChIKey | HCMWTNFMRVKYDO-FIFLTTCUSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|