C10H15N — CID 143819016
(3Z,5E)-6-methyl-2-methylideneocta-3,5,7-trien-1-amine (PubChem CID 143819016) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3Z,5E)-6-methyl-2-methylideneocta-3,5,7-trien-1-amine.
| Compound Name | (3Z,5E)-6-methyl-2-methylideneocta-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 143819016 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3Z,5E)-6-methyl-2-methylideneocta-3,5,7-trien-1-amine |
| SMILES | C=C/C(C)=C/C=C\C(=C)CN |
| InChI | InChI=1S/C10H15N/c1-4-9(2)6-5-7-10(3)8-11/h4-7H,1,3,8,11H2,2H3/b7-5-,9-6+ |
| InChIKey | ODARORNTGKJAOM-XCZNYUDNSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|