About 3-ethenyl-5-methylidenehepta-1,6-diene
3-ethenyl-5-methylidenehepta-1,6-diene (PubChem CID 100997926) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 3-ethenyl-5-methylidenehepta-1,6-diene.
Molecular Properties
| Compound Name | 3-ethenyl-5-methylidenehepta-1,6-diene |
| PubChem CID | 100997926 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 3-ethenyl-5-methylidenehepta-1,6-diene |
| SMILES | C=CC(=C)CC(C=C)C=C |
| InChI | InChI=1S/C10H14/c1-5-9(4)8-10(6-2)7-3/h5-7,10H,1-4,8H2 |
| InChIKey | CVGXUZAOQGWLDS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-5-methylidenehepta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-5-methylidenehepta-1,6-diene?
The IUPAC name of 3-ethenyl-5-methylidenehepta-1,6-diene (CID 100997926) is 3-ethenyl-5-methylidenehepta-1,6-diene.
What is the SMILES notation for 3-ethenyl-5-methylidenehepta-1,6-diene?
The canonical SMILES for 3-ethenyl-5-methylidenehepta-1,6-diene is C=CC(=C)CC(C=C)C=C.
What is the InChIKey of 3-ethenyl-5-methylidenehepta-1,6-diene?
The InChIKey is CVGXUZAOQGWLDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-5-9(4)8-10(6-2)7-3/h5-7,10H,1-4,8H2.
What are the key properties of 3-ethenyl-5-methylidenehepta-1,6-diene?
3-ethenyl-5-methylidenehepta-1,6-diene has a molecular weight of 134.22 g/mol, XLogP of 3.11, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-5-methylidenehepta-1,6-diene is sourced from PubChem (CID 100997926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).