C10H14 — CID 100997926
3-ethenyl-5-methylidenehepta-1,6-diene (PubChem CID 100997926) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 3-ethenyl-5-methylidenehepta-1,6-diene.
| Compound Name | 3-ethenyl-5-methylidenehepta-1,6-diene |
|---|---|
| PubChem CID | 100997926 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 3-ethenyl-5-methylidenehepta-1,6-diene |
| SMILES | C=CC(=C)CC(C=C)C=C |
| InChI | InChI=1S/C10H14/c1-5-9(4)8-10(6-2)7-3/h5-7,10H,1-4,8H2 |
| InChIKey | CVGXUZAOQGWLDS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|