C7H9I — CID 173281600
1-iodo-4-methylidenehexa-1,5-diene (PubChem CID 173281600) has the molecular formula C7H9I and a molecular weight of 220.05 g/mol. Its IUPAC name is 1-iodo-4-methylidenehexa-1,5-diene.
| Compound Name | 1-iodo-4-methylidenehexa-1,5-diene |
|---|---|
| PubChem CID | 173281600 |
| Molecular Formula | C7H9I |
| Molecular Weight | 220.05 g/mol |
| Exact Mass | 219.97 |
| IUPAC Name | 1-iodo-4-methylidenehexa-1,5-diene |
| SMILES | C=CC(=C)CC=CI |
| InChI | InChI=1S/C7H9I/c1-3-7(2)5-4-6-8/h3-4,6H,1-2,5H2 |
| InChIKey | HDXOTUAHTQOVGO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|