C12H20O — CID 142311406
(4E,6Z)-3,5,7-trimethylnona-4,6,8-trien-4-ol (PubChem CID 142311406) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (4E,6Z)-3,5,7-trimethylnona-4,6,8-trien-4-ol.
| Compound Name | (4E,6Z)-3,5,7-trimethylnona-4,6,8-trien-4-ol |
|---|---|
| PubChem CID | 142311406 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (4E,6Z)-3,5,7-trimethylnona-4,6,8-trien-4-ol |
| SMILES | C=C/C(C)=C\C(C)=C(\O)C(C)CC |
| InChI | InChI=1S/C12H20O/c1-6-9(3)8-11(5)12(13)10(4)7-2/h6,8,10,13H,1,7H2,2-5H3/b9-8-,12-11+ |
| InChIKey | ILGIWWDAGPNHRM-UONSLQGUSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|