C13H21Br — CID 170078822
(3Z,5E)-2-bromo-3,4,6,7-tetramethylnona-1,3,5-triene (PubChem CID 170078822) has the molecular formula C13H21Br and a molecular weight of 257.21 g/mol. Its IUPAC name is (3Z,5E)-2-bromo-3,4,6,7-tetramethylnona-1,3,5-triene.
| Compound Name | (3Z,5E)-2-bromo-3,4,6,7-tetramethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 170078822 |
| Molecular Formula | C13H21Br |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (3Z,5E)-2-bromo-3,4,6,7-tetramethylnona-1,3,5-triene |
| SMILES | C=C(Br)/C(C)=C(C)\C=C(/C)C(C)CC |
| InChI | InChI=1S/C13H21Br/c1-7-9(2)10(3)8-11(4)12(5)13(6)14/h8-9H,6-7H2,1-5H3/b10-8+,12-11- |
| InChIKey | JXELNASKUVBQDH-GHGFDZLXSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|