C16H29NO — CID 123419710
N,4,5-trimethyl-N-propan-2-yl-2-propan-2-ylidenehept-3-enamide (PubChem CID 123419710) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is N,4,5-trimethyl-N-propan-2-yl-2-propan-2-ylidenehept-3-enamide.
| Compound Name | N,4,5-trimethyl-N-propan-2-yl-2-propan-2-ylidenehept-3-enamide |
|---|---|
| PubChem CID | 123419710 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N,4,5-trimethyl-N-propan-2-yl-2-propan-2-ylidenehept-3-enamide |
| SMILES | CCC(C)C(C)=CC(C(=O)N(C)C(C)C)=C(C)C |
| InChI | InChI=1S/C16H29NO/c1-9-13(6)14(7)10-15(11(2)3)16(18)17(8)12(4)5/h10,12-13H,9H2,1-8H3 |
| InChIKey | NJZNKVQGJFJDEL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|