C11H20 — CID 123715918
2,5,6-trimethylocta-2,3-diene (PubChem CID 123715918) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 2,5,6-trimethylocta-2,3-diene.
| Compound Name | 2,5,6-trimethylocta-2,3-diene |
|---|---|
| PubChem CID | 123715918 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 2,5,6-trimethylocta-2,3-diene |
| SMILES | CCC(C)C(C)C=C=C(C)C |
| InChI | InChI=1S/C11H20/c1-6-10(4)11(5)8-7-9(2)3/h8,10-11H,6H2,1-5H3 |
| InChIKey | NFWNZLBCVOQBIL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |