C13H24O — CID 59516406
(2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol (PubChem CID 59516406) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol.
| Compound Name | (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol |
|---|---|
| PubChem CID | 59516406 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol |
| SMILES | CC[C@H](C)[C@@H](C)/C=C/C/C(C)=C/CO |
| InChI | InChI=1S/C13H24O/c1-5-12(3)13(4)8-6-7-11(2)9-10-14/h6,8-9,12-14H,5,7,10H2,1-4H3/b8-6+,11-9+/t12-,13-/m0/s1 |
| InChIKey | ZFSYBAWWEIOJID-MEVLGIROSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|