C18H36O2Si — CID 86618041
(2E,5E,7S,8S)-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dien-1-ol (PubChem CID 86618041) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2E,5E,7S,8S)-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dien-1-ol.
| Compound Name | (2E,5E,7S,8S)-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dien-1-ol |
|---|---|
| PubChem CID | 86618041 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2E,5E,7S,8S)-3,7-dimethyl-8-triethylsilyloxydeca-2,5-dien-1-ol |
| SMILES | CC[C@H](O[Si](CC)(CC)CC)[C@@H](C)/C=C/C/C(C)=C/CO |
| InChI | InChI=1S/C18H36O2Si/c1-7-18(20-21(8-2,9-3)10-4)17(6)13-11-12-16(5)14-15-19/h11,13-14,17-19H,7-10,12,15H2,1-6H3/b13-11+,16-14+/t17-,18-/m0/s1 |
| InChIKey | SQGILTUNWCWIRB-ZTDHBFLZSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|