C29H54O3 — CID 158805114
ethyl (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dienoate;methane;(2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol (PubChem CID 158805114) has the molecular formula C29H54O3 and a molecular weight of 450.75 g/mol. Its IUPAC name is ethyl (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dienoate;methane;(2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol.
| Compound Name | ethyl (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dienoate;methane;(2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol |
|---|---|
| PubChem CID | 158805114 |
| Molecular Formula | C29H54O3 |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.41 |
| IUPAC Name | ethyl (2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dienoate;methane;(2E,5E,7R,8S)-3,7,8-trimethyldeca-2,5-dien-1-ol |
| SMILES | C.CCOC(=O)/C=C(\C)C/C=C/[C@H](C)[C@@H](C)CC.CC[C@H](C)[C@@H](C)/C=C/C/C(C)=C/CO |
| InChI | InChI=1S/C15H26O2.C13H24O.CH4/c1-6-13(4)14(5)10-8-9-12(3)11-15(16)17-7-2;1-5-12(3)13(4)8-6-7-11(2)9-10-14;/h8,10-11,13-14H,6-7,9H2,1-5H3;6,8-9,12-14H,5,7,10H2,1-4H3;1H4/b10-8+,12-11+;8-6+,11-9+;/t13-,14-;12-,13-;/m00./s1 |
| InChIKey | ITZAJDDCPURHFS-DMUANGBQSA-N |
| XLogP | 8.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|