C12H22O2 — CID 21079518
(2E,5E)-7-ethoxy-3,7-dimethylocta-2,5-dien-1-ol (PubChem CID 21079518) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2E,5E)-7-ethoxy-3,7-dimethylocta-2,5-dien-1-ol.
| Compound Name | (2E,5E)-7-ethoxy-3,7-dimethylocta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 21079518 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2E,5E)-7-ethoxy-3,7-dimethylocta-2,5-dien-1-ol |
| SMILES | CCOC(C)(C)/C=C/C/C(C)=C/CO |
| InChI | InChI=1S/C12H22O2/c1-5-14-12(3,4)9-6-7-11(2)8-10-13/h6,8-9,13H,5,7,10H2,1-4H3/b9-6+,11-8+ |
| InChIKey | SASKOJUDOBWZLP-DNLSTQPZSA-N |
| XLogP | 2.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|