C22H36O2 — CID 21425189
(2E,5E,8E)-9-(5-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,5,8-trien-1-ol (PubChem CID 21425189) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2E,5E,8E)-9-(5-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,5,8-trien-1-ol.
| Compound Name | (2E,5E,8E)-9-(5-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,5,8-trien-1-ol |
|---|---|
| PubChem CID | 21425189 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2E,5E,8E)-9-(5-ethoxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,5,8-trien-1-ol |
| SMILES | CCOC1CCC(C)=C(/C=C/C(C)/C=C/C/C(C)=C/CO)C1(C)C |
| InChI | InChI=1S/C22H36O2/c1-7-24-21-14-12-19(4)20(22(21,5)6)13-11-17(2)9-8-10-18(3)15-16-23/h8-9,11,13,15,17,21,23H,7,10,12,14,16H2,1-6H3/b9-8+,13-11+,18-15+ |
| InChIKey | TXIBVMPCVOMDIV-GJINJTICSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|