C13H19IO — CID 146186410
(E)-4-(5-iodo-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one (PubChem CID 146186410) has the molecular formula C13H19IO and a molecular weight of 318.20 g/mol. Its IUPAC name is (E)-4-(5-iodo-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one.
| Compound Name | (E)-4-(5-iodo-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 146186410 |
| Molecular Formula | C13H19IO |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | (E)-4-(5-iodo-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C/C1=C(C)CCC(I)C1(C)C |
| InChI | InChI=1S/C13H19IO/c1-9-5-8-12(14)13(3,4)11(9)7-6-10(2)15/h6-7,12H,5,8H2,1-4H3/b7-6+ |
| InChIKey | CLKOEWVAWAPKKV-VOTSOKGWSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|