C15H23NaO3 — CID 70627257
sodium;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one;acetate (PubChem CID 70627257) has the molecular formula C15H23NaO3 and a molecular weight of 274.34 g/mol. Its IUPAC name is sodium;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one;acetate.
| Compound Name | sodium;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one;acetate |
|---|---|
| PubChem CID | 70627257 |
| Molecular Formula | C15H23NaO3 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | sodium;(E)-4-(2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one;acetate |
| SMILES | CC(=O)/C=C/C1=C(C)CCCC1(C)C.CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C13H20O.C2H4O2.Na/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14;1-2(3)4;/h7-8H,5-6,9H2,1-4H3;1H3,(H,3,4);/q;;+1/p-1/b8-7+;; |
| InChIKey | CLNRIBNGCCCLQA-MIIBGCIDSA-M |
| XLogP | -0.58 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|