C40H60 — CID 162639675
1,3,3-trimethyl-2-[(1E,7E,9E,11Z,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,5,7,9,11,13,16-heptaenyl]cyclohexene (PubChem CID 162639675) has the molecular formula C40H60 and a molecular weight of 540.92 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E,7E,9E,11Z,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,5,7,9,11,13,16-heptaenyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E,7E,9E,11Z,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,5,7,9,11,13,16-heptaenyl]cyclohexene |
|---|---|
| PubChem CID | 162639675 |
| Molecular Formula | C40H60 |
| Molecular Weight | 540.92 g/mol |
| Exact Mass | 540.47 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E,7E,9E,11Z,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,5,7,9,11,13,16-heptaenyl]cyclohexene |
| SMILES | CC1=C(/C=C/C(C)CC=C/C(C)=C/C=C/C=C(C)\C=C\C/C(C)=C/CC2=C(C)CCCC2(C)C)C(C)(C)CCC1 |
| InChI | InChI=1S/C40H60/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-20,25-27,33H,15-16,21-24,28-30H2,1-10H3/b12-11+,19-13?,20-14+,27-25+,31-17+,32-18-,34-26+ |
| InChIKey | CNJRIFBUYVPWEJ-ZGLNCYJJSA-N |
| XLogP | 12.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.92 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|