C40H58 — CID 170459249
2,6,6-trimethyl-1-[(1E,3E,5E,8E,10E,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,8,10,13,16-heptaenyl]cyclohexa-1,3-diene (PubChem CID 170459249) has the molecular formula C40H58 and a molecular weight of 538.90 g/mol. Its IUPAC name is 2,6,6-trimethyl-1-[(1E,3E,5E,8E,10E,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,8,10,13,16-heptaenyl]cyclohexa-1,3-diene.
| Compound Name | 2,6,6-trimethyl-1-[(1E,3E,5E,8E,10E,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,8,10,13,16-heptaenyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170459249 |
| Molecular Formula | C40H58 |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 538.45 |
| IUPAC Name | 2,6,6-trimethyl-1-[(1E,3E,5E,8E,10E,13E,16E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,8,10,13,16-heptaenyl]cyclohexa-1,3-diene |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)/C=C/C=C/C(C)/C=C/C/C(C)=C/CC2=C(C)CCCC2(C)C)C(C)(C)CC=C1 |
| InChI | InChI=1S/C40H58/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-15,17-21,23,25-27,31-32H,16,22,24,28-30H2,1-10H3/b17-11+,18-12+,19-13+,20-14+,27-25+,33-21+,34-26+ |
| InChIKey | DHMPCIWXGCEZKA-KECZZFOJSA-N |
| XLogP | 12.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|