C19H33O3P — CID 173224633
butan-2-yloxy-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl]phosphinic acid (PubChem CID 173224633) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is butan-2-yloxy-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl]phosphinic acid.
| Compound Name | butan-2-yloxy-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl]phosphinic acid |
|---|---|
| PubChem CID | 173224633 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | butan-2-yloxy-[3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dienyl]phosphinic acid |
| SMILES | CCC(C)OP(=O)(O)C=CC(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C19H33O3P/c1-7-17(4)22-23(20,21)14-12-15(2)10-11-18-16(3)9-8-13-19(18,5)6/h10-12,14-15,17H,7-9,13H2,1-6H3,(H,20,21) |
| InChIKey | UNUHCUXMZNMVBO-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|