C21H37O3P — CID 139767907
2-(5-dipropoxyphosphoryl-3-methylpenta-1,3-dienyl)-1,3,3-trimethylcyclohexene (PubChem CID 139767907) has the molecular formula C21H37O3P and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-(5-dipropoxyphosphoryl-3-methylpenta-1,3-dienyl)-1,3,3-trimethylcyclohexene.
| Compound Name | 2-(5-dipropoxyphosphoryl-3-methylpenta-1,3-dienyl)-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 139767907 |
| Molecular Formula | C21H37O3P |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-(5-dipropoxyphosphoryl-3-methylpenta-1,3-dienyl)-1,3,3-trimethylcyclohexene |
| SMILES | CCCOP(=O)(CC=C(C)C=CC1=C(C)CCCC1(C)C)OCCC |
| InChI | InChI=1S/C21H37O3P/c1-7-15-23-25(22,24-16-8-2)17-13-18(3)11-12-20-19(4)10-9-14-21(20,5)6/h11-13H,7-10,14-17H2,1-6H3 |
| InChIKey | RHUJIKLJUJLPPX-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|