About 3,4-dimethylhex-1-en-1-one
3,4-dimethylhex-1-en-1-one (PubChem CID 177362101) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 3,4-dimethylhex-1-en-1-one.
Molecular Properties
| Compound Name | 3,4-dimethylhex-1-en-1-one |
| PubChem CID | 177362101 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 3,4-dimethylhex-1-en-1-one |
| SMILES | CCC(C)C(C)C=C=O |
| InChI | InChI=1S/C8H14O/c1-4-7(2)8(3)5-6-9/h5,7-8H,4H2,1-3H3 |
| InChIKey | WMKXKCRPPIHCBT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylhex-1-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylhex-1-en-1-one?
The IUPAC name of 3,4-dimethylhex-1-en-1-one (CID 177362101) is 3,4-dimethylhex-1-en-1-one.
What is the SMILES notation for 3,4-dimethylhex-1-en-1-one?
The canonical SMILES for 3,4-dimethylhex-1-en-1-one is CCC(C)C(C)C=C=O.
What is the InChIKey of 3,4-dimethylhex-1-en-1-one?
The InChIKey is WMKXKCRPPIHCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-4-7(2)8(3)5-6-9/h5,7-8H,4H2,1-3H3.
What are the key properties of 3,4-dimethylhex-1-en-1-one?
3,4-dimethylhex-1-en-1-one has a molecular weight of 126.20 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylhex-1-en-1-one is sourced from PubChem (CID 177362101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).