C7H11BrO — CID 123418656
3-(bromomethyl)-4-methoxypenta-1,3-diene (PubChem CID 123418656) has the molecular formula C7H11BrO and a molecular weight of 191.07 g/mol. Its IUPAC name is 3-(bromomethyl)-4-methoxypenta-1,3-diene.
| Compound Name | 3-(bromomethyl)-4-methoxypenta-1,3-diene |
|---|---|
| PubChem CID | 123418656 |
| Molecular Formula | C7H11BrO |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 3-(bromomethyl)-4-methoxypenta-1,3-diene |
| SMILES | C=CC(CBr)=C(C)OC |
| InChI | InChI=1S/C7H11BrO/c1-4-7(5-8)6(2)9-3/h4H,1,5H2,2-3H3 |
| InChIKey | UNIMSYPYSNEMLZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|