C12H19NO2 — CID 143510206
(2Z,3E)-2-[1-(dimethylamino)propan-2-ylidene]-4-methoxyhexa-3,5-dienal (PubChem CID 143510206) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (2Z,3E)-2-[1-(dimethylamino)propan-2-ylidene]-4-methoxyhexa-3,5-dienal.
| Compound Name | (2Z,3E)-2-[1-(dimethylamino)propan-2-ylidene]-4-methoxyhexa-3,5-dienal |
|---|---|
| PubChem CID | 143510206 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (2Z,3E)-2-[1-(dimethylamino)propan-2-ylidene]-4-methoxyhexa-3,5-dienal |
| SMILES | C=C/C(=C\C(C=O)=C(/C)CN(C)C)OC |
| InChI | InChI=1S/C12H19NO2/c1-6-12(15-5)7-11(9-14)10(2)8-13(3)4/h6-7,9H,1,8H2,2-5H3/b11-10-,12-7+ |
| InChIKey | CNUYUOQCSIUFQL-LVILPVEGSA-N |
| XLogP | 1.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|