C7H14OSi — CID 173400885
[(1Z)-1-methoxybuta-1,3-dienyl]-dimethylsilane (PubChem CID 173400885) has the molecular formula C7H14OSi and a molecular weight of 142.27 g/mol. Its IUPAC name is [(1Z)-1-methoxybuta-1,3-dienyl]-dimethylsilane.
| Compound Name | [(1Z)-1-methoxybuta-1,3-dienyl]-dimethylsilane |
|---|---|
| PubChem CID | 173400885 |
| Molecular Formula | C7H14OSi |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | [(1Z)-1-methoxybuta-1,3-dienyl]-dimethylsilane |
| SMILES | C=C/C=C(/OC)[SiH](C)C |
| InChI | InChI=1S/C7H14OSi/c1-5-6-7(8-2)9(3)4/h5-6,9H,1H2,2-4H3/b7-6- |
| InChIKey | JBYHCXZFGYIYGQ-SREVYHEPSA-N |
| XLogP | 1.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|