C7H9NO — CID 145016695
(1E)-N-ethynyl-1-methoxybuta-1,3-dien-1-amine (PubChem CID 145016695) has the molecular formula C7H9NO and a molecular weight of 123.15 g/mol. Its IUPAC name is (1E)-N-ethynyl-1-methoxybuta-1,3-dien-1-amine.
| Compound Name | (1E)-N-ethynyl-1-methoxybuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145016695 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (1E)-N-ethynyl-1-methoxybuta-1,3-dien-1-amine |
| SMILES | C#CN/C(=C\C=C)OC |
| InChI | InChI=1S/C7H9NO/c1-4-6-7(9-3)8-5-2/h2,4,6,8H,1H2,3H3/b7-6+ |
| InChIKey | SWUPIJZNYKUSKA-VOTSOKGWSA-N |
| XLogP | 0.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|