C10H18N2 — CID 143110018
(3E)-3-methylhexa-3,5-diene-1,2-diamine;prop-1-yne (PubChem CID 143110018) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (3E)-3-methylhexa-3,5-diene-1,2-diamine;prop-1-yne.
| Compound Name | (3E)-3-methylhexa-3,5-diene-1,2-diamine;prop-1-yne |
|---|---|
| PubChem CID | 143110018 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (3E)-3-methylhexa-3,5-diene-1,2-diamine;prop-1-yne |
| SMILES | C#CC.C=C/C=C(\C)C(N)CN |
| InChI | InChI=1S/C7H14N2.C3H4/c1-3-4-6(2)7(9)5-8;1-3-2/h3-4,7H,1,5,8-9H2,2H3;1H,2H3/b6-4+; |
| InChIKey | BQXTWHRRUPPKOQ-CVDVRWGVSA-N |
| XLogP | 1.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|