C7H12O2 — CID 123362544
2-penta-2,4-dien-2-yloxyethanol (PubChem CID 123362544) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-penta-2,4-dien-2-yloxyethanol.
| Compound Name | 2-penta-2,4-dien-2-yloxyethanol |
|---|---|
| PubChem CID | 123362544 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 2-penta-2,4-dien-2-yloxyethanol |
| SMILES | C=CC=C(C)OCCO |
| InChI | InChI=1S/C7H12O2/c1-3-4-7(2)9-6-5-8/h3-4,8H,1,5-6H2,2H3 |
| InChIKey | WYNNVVIFUUOUHW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|