C8H15NOS — CID 142180502
(3Z)-1-methoxy-3-methylsulfanylhexa-3,5-dien-2-amine (PubChem CID 142180502) has the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. Its IUPAC name is (3Z)-1-methoxy-3-methylsulfanylhexa-3,5-dien-2-amine.
| Compound Name | (3Z)-1-methoxy-3-methylsulfanylhexa-3,5-dien-2-amine |
|---|---|
| PubChem CID | 142180502 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | (3Z)-1-methoxy-3-methylsulfanylhexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\SC)C(N)COC |
| InChI | InChI=1S/C8H15NOS/c1-4-5-8(11-3)7(9)6-10-2/h4-5,7H,1,6,9H2,2-3H3/b8-5- |
| InChIKey | NCWHNMVVJWIPPN-YVMONPNESA-N |
| XLogP | 1.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|