About 2-methoxybut-1-en-3-yne
2-methoxybut-1-en-3-yne (PubChem CID 11126175) has the molecular formula C5H6O
and a molecular weight of 82.10 g/mol. Its IUPAC name is 2-methoxybut-1-en-3-yne.
Molecular Properties
| Compound Name | 2-methoxybut-1-en-3-yne |
| PubChem CID | 11126175 |
| Molecular Formula | C5H6O |
| Molecular Weight | 82.10 g/mol |
| Exact Mass | 82.04 |
| IUPAC Name | 2-methoxybut-1-en-3-yne |
| SMILES | C#CC(=C)OC |
| InChI | InChI=1S/C5H6O/c1-4-5(2)6-3/h1H,2H2,3H3 |
| InChIKey | SYYKUPKSKSHFEN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.10 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxybut-1-en-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybut-1-en-3-yne?
The IUPAC name of 2-methoxybut-1-en-3-yne (CID 11126175) is 2-methoxybut-1-en-3-yne.
What is the SMILES notation for 2-methoxybut-1-en-3-yne?
The canonical SMILES for 2-methoxybut-1-en-3-yne is C#CC(=C)OC.
What is the InChIKey of 2-methoxybut-1-en-3-yne?
The InChIKey is SYYKUPKSKSHFEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O/c1-4-5(2)6-3/h1H,2H2,3H3.
What are the key properties of 2-methoxybut-1-en-3-yne?
2-methoxybut-1-en-3-yne has a molecular weight of 82.10 g/mol, XLogP of 0.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybut-1-en-3-yne is sourced from PubChem (CID 11126175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).