C10H10O2 — CID 145244673
(4E)-4-[(Z)-2-methoxyethenyl]hepta-4,6-dien-1-yn-3-one (PubChem CID 145244673) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (4E)-4-[(Z)-2-methoxyethenyl]hepta-4,6-dien-1-yn-3-one.
| Compound Name | (4E)-4-[(Z)-2-methoxyethenyl]hepta-4,6-dien-1-yn-3-one |
|---|---|
| PubChem CID | 145244673 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (4E)-4-[(Z)-2-methoxyethenyl]hepta-4,6-dien-1-yn-3-one |
| SMILES | C#CC(=O)C(/C=C\OC)=C/C=C |
| InChI | InChI=1S/C10H10O2/c1-4-6-9(7-8-12-3)10(11)5-2/h2,4,6-8H,1H2,3H3/b8-7-,9-6+ |
| InChIKey | ARBGUUQDCLTBMX-SOKJVCRVSA-N |
| XLogP | 1.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|