C10H18N2O — CID 143851447
ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide (PubChem CID 143851447) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide.
| Compound Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide |
|---|---|
| PubChem CID | 143851447 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | ethane;(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienehydrazide |
| SMILES | C=C/C=C(\C=C/C)C(=O)NN.CC |
| InChI | InChI=1S/C8H12N2O.C2H6/c1-3-5-7(6-4-2)8(11)10-9;1-2/h3-6H,1,9H2,2H3,(H,10,11);1-2H3/b6-4-,7-5+; |
| InChIKey | JVLJFPYTKBWOFA-ZMVRXXEHSA-N |
| XLogP | 1.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|