C16H24N2 — CID 145261283
[(3E,5Z,8Z,9Z)-8-ethylidene-4-[(Z)-prop-1-enyl]undeca-1,3,5,9-tetraen-5-yl]hydrazine (PubChem CID 145261283) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is [(3E,5Z,8Z,9Z)-8-ethylidene-4-[(Z)-prop-1-enyl]undeca-1,3,5,9-tetraen-5-yl]hydrazine.
| Compound Name | [(3E,5Z,8Z,9Z)-8-ethylidene-4-[(Z)-prop-1-enyl]undeca-1,3,5,9-tetraen-5-yl]hydrazine |
|---|---|
| PubChem CID | 145261283 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | [(3E,5Z,8Z,9Z)-8-ethylidene-4-[(Z)-prop-1-enyl]undeca-1,3,5,9-tetraen-5-yl]hydrazine |
| SMILES | C=C/C=C(\C=C/C)C(=C/CC(/C=C\C)=C/C)/NN |
| InChI | InChI=1S/C16H24N2/c1-5-9-14(8-4)12-13-16(18-17)15(10-6-2)11-7-3/h5-11,13,18H,2,12,17H2,1,3-4H3/b9-5-,11-7-,14-8+,15-10+,16-13- |
| InChIKey | FGTBDVFWZJOWIN-FVMIOHCQSA-N |
| XLogP | 3.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|