About sodium;hydride;3-methoxyprop-2-enoic acid
sodium;hydride;3-methoxyprop-2-enoic acid (PubChem CID 175287980) has the molecular formula C4H7NaO3
and a molecular weight of 126.09 g/mol. Its IUPAC name is sodium;hydride;3-methoxyprop-2-enoic acid.
Molecular Properties
| Compound Name | sodium;hydride;3-methoxyprop-2-enoic acid |
| PubChem CID | 175287980 |
| Molecular Formula | C4H7NaO3 |
| Molecular Weight | 126.09 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | sodium;hydride;3-methoxyprop-2-enoic acid |
| SMILES | COC=CC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C4H6O3.Na.H/c1-7-3-2-4(5)6;;/h2-3H,1H3,(H,5,6);;/q;+1;-1 |
| InChIKey | XCIDMYKWPJAQEZ-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.09 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;3-methoxyprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;3-methoxyprop-2-enoic acid?
The IUPAC name of sodium;hydride;3-methoxyprop-2-enoic acid (CID 175287980) is sodium;hydride;3-methoxyprop-2-enoic acid.
What is the SMILES notation for sodium;hydride;3-methoxyprop-2-enoic acid?
The canonical SMILES for sodium;hydride;3-methoxyprop-2-enoic acid is COC=CC(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;3-methoxyprop-2-enoic acid?
The InChIKey is XCIDMYKWPJAQEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.Na.H/c1-7-3-2-4(5)6;;/h2-3H,1H3,(H,5,6);;/q;+1;-1.
What are the key properties of sodium;hydride;3-methoxyprop-2-enoic acid?
sodium;hydride;3-methoxyprop-2-enoic acid has a molecular weight of 126.09 g/mol, XLogP of -2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;3-methoxyprop-2-enoic acid is sourced from PubChem (CID 175287980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).