C6H10N4O2 — CID 88838427
(2Z,4Z)-hexa-2,4-dienedihydrazide (PubChem CID 88838427) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is (2Z,4Z)-hexa-2,4-dienedihydrazide.
| Compound Name | (2Z,4Z)-hexa-2,4-dienedihydrazide |
|---|---|
| PubChem CID | 88838427 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (2Z,4Z)-hexa-2,4-dienedihydrazide |
| SMILES | NNC(=O)/C=C\C=C/C(=O)NN |
| InChI | InChI=1S/C6H10N4O2/c7-9-5(11)3-1-2-4-6(12)10-8/h1-4H,7-8H2,(H,9,11)(H,10,12)/b3-1-,4-2- |
| InChIKey | ODXKSNWISLHFPE-CCAGOZQPSA-N |
| XLogP | -1.92 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|