About 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid
3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid (PubChem CID 159829853) has the molecular formula C8H8Cl2N4O3
and a molecular weight of 279.08 g/mol. Its IUPAC name is 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid |
| PubChem CID | 159829853 |
| Molecular Formula | C8H8Cl2N4O3 |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid |
| SMILES | Clc1ccc(Cl)nn1.NNC(=O)/C=C\C(=O)O |
| InChI | InChI=1S/C4H2Cl2N2.C4H6N2O3/c5-3-1-2-4(6)8-7-3;5-6-3(7)1-2-4(8)9/h1-2H;1-2H,5H2,(H,6,7)(H,8,9)/b;2-1- |
| InChIKey | NNHZIVCWMBSRET-BTJKTKAUSA-N |
| XLogP | 0.40 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid?
The IUPAC name of 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid (CID 159829853) is 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid.
What is the SMILES notation for 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid?
The canonical SMILES for 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid is Clc1ccc(Cl)nn1.NNC(=O)/C=C\C(=O)O.
What is the InChIKey of 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid?
The InChIKey is NNHZIVCWMBSRET-BTJKTKAUSA-N. The full InChI is InChI=1S/C4H2Cl2N2.C4H6N2O3/c5-3-1-2-4(6)8-7-3;5-6-3(7)1-2-4(8)9/h1-2H;1-2H,5H2,(H,6,7)(H,8,9)/b;2-1-.
What are the key properties of 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid?
3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid has a molecular weight of 279.08 g/mol, XLogP of 0.40, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dichloropyridazine;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid is sourced from PubChem (CID 159829853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).