C12H15ClN4O4 — CID 158963891
(E)-but-2-enedioic acid;3-chloro-6-piperazin-1-ylpyridazine (PubChem CID 158963891) has the molecular formula C12H15ClN4O4 and a molecular weight of 314.73 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-chloro-6-piperazin-1-ylpyridazine.
| Compound Name | (E)-but-2-enedioic acid;3-chloro-6-piperazin-1-ylpyridazine |
|---|---|
| PubChem CID | 158963891 |
| Molecular Formula | C12H15ClN4O4 |
| Molecular Weight | 314.73 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (E)-but-2-enedioic acid;3-chloro-6-piperazin-1-ylpyridazine |
| SMILES | Clc1ccc(N2CCNCC2)nn1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H11ClN4.C4H4O4/c9-7-1-2-8(12-11-7)13-5-3-10-4-6-13;5-3(6)1-2-4(7)8/h1-2,10H,3-6H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JMYNBUGFZQMMNR-WLHGVMLRSA-N |
| XLogP | 0.25 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.73 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|