C11H12ClN3O — CID 59303878
CID 59303878 (PubChem CID 59303878) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol.
| Compound Name | CID 59303878 |
|---|---|
| PubChem CID | 59303878 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)C1CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C11H12ClN3O/c1-8(16)9-4-6-15(7-5-9)11-3-2-10(12)13-14-11/h1-3,9H,4-7H2 |
| InChIKey | YHYILYXHLFBNJX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |