C12H17ClN4O2 — CID 15124700
ethyl N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]carbamate (PubChem CID 15124700) has the molecular formula C12H17ClN4O2 and a molecular weight of 284.75 g/mol. Its IUPAC name is ethyl N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 15124700 |
| Molecular Formula | C12H17ClN4O2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | ethyl N-[1-(6-chloropyridazin-3-yl)piperidin-4-yl]carbamate |
| SMILES | CCOC(=O)NC1CCN(c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C12H17ClN4O2/c1-2-19-12(18)14-9-5-7-17(8-6-9)11-4-3-10(13)15-16-11/h3-4,9H,2,5-8H2,1H3,(H,14,18) |
| InChIKey | KCAXGVOVPRGHHB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |