C7H7N3O3 — CID 71670290
(E)-4-oxo-4-(1H-pyrazol-5-ylamino)but-2-enoic acid (PubChem CID 71670290) has the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. Its IUPAC name is (E)-4-oxo-4-(1H-pyrazol-5-ylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(1H-pyrazol-5-ylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 71670290 |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.15 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | (E)-4-oxo-4-(1H-pyrazol-5-ylamino)but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H7N3O3/c11-6(1-2-7(12)13)9-5-3-4-8-10-5/h1-4H,(H,12,13)(H2,8,9,10,11)/b2-1+ |
| InChIKey | QPKKFCZPTIZVKB-OWOJBTEDSA-N |
| XLogP | -0.01 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|