C7H9N3O4 — CID 61393398
2-[2-oxo-2-(1H-pyrazol-5-ylamino)ethoxy]acetic acid (PubChem CID 61393398) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-[2-oxo-2-(1H-pyrazol-5-ylamino)ethoxy]acetic acid.
| Compound Name | 2-[2-oxo-2-(1H-pyrazol-5-ylamino)ethoxy]acetic acid |
|---|---|
| PubChem CID | 61393398 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-[2-oxo-2-(1H-pyrazol-5-ylamino)ethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C7H9N3O4/c11-6(3-14-4-7(12)13)9-5-1-2-8-10-5/h1-2H,3-4H2,(H,12,13)(H2,8,9,10,11) |
| InChIKey | UUQNGMSWXCZXEW-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |