C10H9Cl2NO4 — CID 2732298
2-[2-(3,5-dichloroanilino)-2-oxoethoxy]acetic acid (PubChem CID 2732298) has the molecular formula C10H9Cl2NO4 and a molecular weight of 278.09 g/mol. Its IUPAC name is 2-[2-(3,5-dichloroanilino)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(3,5-dichloroanilino)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 2732298 |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 2-[2-(3,5-dichloroanilino)-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO4/c11-6-1-7(12)3-8(2-6)13-9(14)4-17-5-10(15)16/h1-3H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | YBLMXSZLRLVNPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |