C11H11N3O2 — CID 61393608
3-(5-methylfuran-2-yl)-N-(1H-pyrazol-5-yl)prop-2-enamide (PubChem CID 61393608) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-(5-methylfuran-2-yl)-N-(1H-pyrazol-5-yl)prop-2-enamide.
| Compound Name | 3-(5-methylfuran-2-yl)-N-(1H-pyrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 61393608 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(5-methylfuran-2-yl)-N-(1H-pyrazol-5-yl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2ccn[nH]2)o1 |
| InChI | InChI=1S/C11H11N3O2/c1-8-2-3-9(16-8)4-5-11(15)13-10-6-7-12-14-10/h2-7H,1H3,(H2,12,13,14,15) |
| InChIKey | VASFGKCQSXEYLX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|