C4H6K2N2O11S2 — CID 174816978
dipotassium;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;sulfonatooxy sulfate (PubChem CID 174816978) has the molecular formula C4H6K2N2O11S2 and a molecular weight of 400.43 g/mol. Its IUPAC name is dipotassium;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;sulfonatooxy sulfate.
| Compound Name | dipotassium;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;sulfonatooxy sulfate |
|---|---|
| PubChem CID | 174816978 |
| Molecular Formula | C4H6K2N2O11S2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 399.87 |
| IUPAC Name | dipotassium;(Z)-4-hydrazinyl-4-oxobut-2-enoic acid;sulfonatooxy sulfate |
| SMILES | NNC(=O)/C=C\C(=O)O.O=S(=O)([O-])OOS(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C4H6N2O3.2K.H2O8S2/c5-6-3(7)1-2-4(8)9;;;1-9(2,3)7-8-10(4,5)6/h1-2H,5H2,(H,6,7)(H,8,9);;;(H,1,2,3)(H,4,5,6)/q;2*+1;/p-2/b2-1-;;; |
| InChIKey | VKTNWDZTPBBRRW-GRHBHMESSA-L |
| XLogP | -9.52 |
| TPSA | 225.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | -9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|