C11H13NO — CID 166458880
N-[(3Z,5E)-5-ethynyl-2-methylidenehepta-3,5-dienyl]formamide (PubChem CID 166458880) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is N-[(3Z,5E)-5-ethynyl-2-methylidenehepta-3,5-dienyl]formamide.
| Compound Name | N-[(3Z,5E)-5-ethynyl-2-methylidenehepta-3,5-dienyl]formamide |
|---|---|
| PubChem CID | 166458880 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-[(3Z,5E)-5-ethynyl-2-methylidenehepta-3,5-dienyl]formamide |
| SMILES | C#CC(/C=C\C(=C)CNC=O)=C/C |
| InChI | InChI=1S/C11H13NO/c1-4-11(5-2)7-6-10(3)8-12-9-13/h1,5-7,9H,3,8H2,2H3,(H,12,13)/b7-6-,11-5- |
| InChIKey | HFGLKILSQGLYCG-PDDHADQFSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|