C4H9N3O2 — CID 145297208
N-[2-(2-methylhydrazinyl)-2-oxoethyl]formamide (PubChem CID 145297208) has the molecular formula C4H9N3O2 and a molecular weight of 131.14 g/mol. Its IUPAC name is N-[2-(2-methylhydrazinyl)-2-oxoethyl]formamide.
| Compound Name | N-[2-(2-methylhydrazinyl)-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 145297208 |
| Molecular Formula | C4H9N3O2 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | N-[2-(2-methylhydrazinyl)-2-oxoethyl]formamide |
| SMILES | CNNC(=O)CNC=O |
| InChI | InChI=1S/C4H9N3O2/c1-5-7-4(9)2-6-3-8/h3,5H,2H2,1H3,(H,6,8)(H,7,9) |
| InChIKey | ZOAOFOWREFBUMK-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|